C16H22N2O6 — CID 141367843
6-[(6-hydroxy-1,5-dimethoxycyclohexa-2,4-dien-1-yl)diazenyl]-2,6-dimethoxycyclohexa-2,4-dien-1-ol (PubChem CID 141367843) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 6-[(6-hydroxy-1,5-dimethoxycyclohexa-2,4-dien-1-yl)diazenyl]-2,6-dimethoxycyclohexa-2,4-dien-1-ol.
| Compound Name | 6-[(6-hydroxy-1,5-dimethoxycyclohexa-2,4-dien-1-yl)diazenyl]-2,6-dimethoxycyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 141367843 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-[(6-hydroxy-1,5-dimethoxycyclohexa-2,4-dien-1-yl)diazenyl]-2,6-dimethoxycyclohexa-2,4-dien-1-ol |
| SMILES | COC1=CC=CC(N=NC2(OC)C=CC=C(OC)C2O)(OC)C1O |
| InChI | InChI=1S/C16H22N2O6/c1-21-11-7-5-9-15(23-3,13(11)19)17-18-16(24-4)10-6-8-12(22-2)14(16)20/h5-10,13-14,19-20H,1-4H3 |
| InChIKey | ZYSJUPWZXJQZFZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|