C7H9BrO3 — CID 134895716
(1S,2R)-3-bromo-6-methoxycyclohexa-3,5-diene-1,2-diol (PubChem CID 134895716) has the molecular formula C7H9BrO3 and a molecular weight of 221.05 g/mol. Its IUPAC name is (1S,2R)-3-bromo-6-methoxycyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-bromo-6-methoxycyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 134895716 |
| Molecular Formula | C7H9BrO3 |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | (1S,2R)-3-bromo-6-methoxycyclohexa-3,5-diene-1,2-diol |
| SMILES | COC1=CC=C(Br)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H9BrO3/c1-11-5-3-2-4(8)6(9)7(5)10/h2-3,6-7,9-10H,1H3/t6-,7+/m0/s1 |
| InChIKey | DOKTVVBCHYXXFC-NKWVEPMBSA-N |
| XLogP | 0.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |