C7H9ClO4 — CID 131080225
(4S,5R,6R)-6-chloro-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one (PubChem CID 131080225) has the molecular formula C7H9ClO4 and a molecular weight of 192.60 g/mol. Its IUPAC name is (4S,5R,6R)-6-chloro-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one.
| Compound Name | (4S,5R,6R)-6-chloro-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 131080225 |
| Molecular Formula | C7H9ClO4 |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | (4S,5R,6R)-6-chloro-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one |
| SMILES | COC1=CC(=O)[C@H](Cl)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H9ClO4/c1-12-4-2-3(9)5(8)7(11)6(4)10/h2,5-7,10-11H,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | QSEIAQVQXUHJCV-XVMARJQXSA-N |
| XLogP | -0.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|