C6H8O4 — CID 95224942
(3R)-3-hydroxy-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 95224942) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-methoxy-2,3-dihydropyran-6-one.
| Compound Name | (3R)-3-hydroxy-4-methoxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 95224942 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3R)-3-hydroxy-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)OC[C@H]1O |
| InChI | InChI=1S/C6H8O4/c1-9-5-2-6(8)10-3-4(5)7/h2,4,7H,3H2,1H3/t4-/m1/s1 |
| InChIKey | PBEXSRJMCVDBFK-SCSAIBSYSA-N |
| XLogP | -0.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |