C9H12O5 — CID 19010986
6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydroisochromen-3-one (PubChem CID 19010986) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydroisochromen-3-one.
| Compound Name | 6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydroisochromen-3-one |
|---|---|
| PubChem CID | 19010986 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydroisochromen-3-one |
| SMILES | O=C1C=C2CC(O)C(O)C(O)C2CO1 |
| InChI | InChI=1S/C9H12O5/c10-6-1-4-2-7(11)14-3-5(4)8(12)9(6)13/h2,5-6,8-10,12-13H,1,3H2 |
| InChIKey | RTCFSHPOELZHDW-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |