C12H12O2 — CID 101419577
3-methyl-4-phenyl-2,3-dihydropyran-6-one (PubChem CID 101419577) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-methyl-4-phenyl-2,3-dihydropyran-6-one.
| Compound Name | 3-methyl-4-phenyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 101419577 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-methyl-4-phenyl-2,3-dihydropyran-6-one |
| SMILES | CC1COC(=O)C=C1c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-9-8-14-12(13)7-11(9)10-5-3-2-4-6-10/h2-7,9H,8H2,1H3 |
| InChIKey | BMAKPIWGRGOBQN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |