C18H16FN — CID 140708544
5-(4-fluorophenyl)-4-methyl-2-phenyl-3,4-dihydropyridine (PubChem CID 140708544) has the molecular formula C18H16FN and a molecular weight of 265.33 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-methyl-2-phenyl-3,4-dihydropyridine.
| Compound Name | 5-(4-fluorophenyl)-4-methyl-2-phenyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 140708544 |
| Molecular Formula | C18H16FN |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 5-(4-fluorophenyl)-4-methyl-2-phenyl-3,4-dihydropyridine |
| SMILES | CC1CC(c2ccccc2)=NC=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN/c1-13-11-18(15-5-3-2-4-6-15)20-12-17(13)14-7-9-16(19)10-8-14/h2-10,12-13H,11H2,1H3 |
| InChIKey | BQGQDMYIYHSVOE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |