C20H25N — CID 142821130
2,5-diphenyl-3,4-dihydropyridine;ethane;methane (PubChem CID 142821130) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 2,5-diphenyl-3,4-dihydropyridine;ethane;methane.
| Compound Name | 2,5-diphenyl-3,4-dihydropyridine;ethane;methane |
|---|---|
| PubChem CID | 142821130 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2,5-diphenyl-3,4-dihydropyridine;ethane;methane |
| SMILES | C.C1=C(c2ccccc2)CCC(c2ccccc2)=N1.CC |
| InChI | InChI=1S/C17H15N.C2H6.CH4/c1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15;1-2;/h1-10,13H,11-12H2;1-2H3;1H4 |
| InChIKey | YQOHUCRMZCZSPD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |