C14H18N2 — CID 170789927
(1R)-1-(2-phenyl-4,5-dihydro-3H-azepin-6-yl)ethanamine (PubChem CID 170789927) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (1R)-1-(2-phenyl-4,5-dihydro-3H-azepin-6-yl)ethanamine.
| Compound Name | (1R)-1-(2-phenyl-4,5-dihydro-3H-azepin-6-yl)ethanamine |
|---|---|
| PubChem CID | 170789927 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (1R)-1-(2-phenyl-4,5-dihydro-3H-azepin-6-yl)ethanamine |
| SMILES | C[C@@H](N)C1=CN=C(c2ccccc2)CCC1 |
| InChI | InChI=1S/C14H18N2/c1-11(15)13-8-5-9-14(16-10-13)12-6-3-2-4-7-12/h2-4,6-7,10-11H,5,8-9,15H2,1H3/t11-/m1/s1 |
| InChIKey | NOLRUZQTLJZZJB-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |