C14H17N3 — CID 83850126
1-(2,5-dimethyl-6-phenylpyrimidin-4-yl)ethanamine (PubChem CID 83850126) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(2,5-dimethyl-6-phenylpyrimidin-4-yl)ethanamine.
| Compound Name | 1-(2,5-dimethyl-6-phenylpyrimidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 83850126 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 1-(2,5-dimethyl-6-phenylpyrimidin-4-yl)ethanamine |
| SMILES | Cc1nc(-c2ccccc2)c(C)c(C(C)N)n1 |
| InChI | InChI=1S/C14H17N3/c1-9-13(10(2)15)16-11(3)17-14(9)12-7-5-4-6-8-12/h4-8,10H,15H2,1-3H3 |
| InChIKey | RSYLTDCYUIZYJB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |