C17H18N2 — CID 175418789
azane;1,4-dimethyl-3-phenylisoquinoline (PubChem CID 175418789) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is azane;1,4-dimethyl-3-phenylisoquinoline.
| Compound Name | azane;1,4-dimethyl-3-phenylisoquinoline |
|---|---|
| PubChem CID | 175418789 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | azane;1,4-dimethyl-3-phenylisoquinoline |
| SMILES | Cc1nc(-c2ccccc2)c(C)c2ccccc12.N |
| InChI | InChI=1S/C17H15N.H3N/c1-12-15-10-6-7-11-16(15)13(2)18-17(12)14-8-4-3-5-9-14;/h3-11H,1-2H3;1H3 |
| InChIKey | WJQGPFXJJZCHID-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |