C6H9FO4 — CID 58957406
(3R,5R)-3-fluoro-4,5-dihydroxy-3-methyloxan-2-one (PubChem CID 58957406) has the molecular formula C6H9FO4 and a molecular weight of 164.13 g/mol. Its IUPAC name is (3R,5R)-3-fluoro-4,5-dihydroxy-3-methyloxan-2-one.
| Compound Name | (3R,5R)-3-fluoro-4,5-dihydroxy-3-methyloxan-2-one |
|---|---|
| PubChem CID | 58957406 |
| Molecular Formula | C6H9FO4 |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | (3R,5R)-3-fluoro-4,5-dihydroxy-3-methyloxan-2-one |
| SMILES | C[C@]1(F)C(=O)OC[C@@H](O)C1O |
| InChI | InChI=1S/C6H9FO4/c1-6(7)4(9)3(8)2-11-5(6)10/h3-4,8-9H,2H2,1H3/t3-,4?,6-/m1/s1 |
| InChIKey | YDJDQSWMXPFLIJ-RSJRKSSKSA-N |
| XLogP | -1.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |