C6H12O6 — CID 102312079
(2R,4R,5R)-2-methyloxane-2,3,3,4,5-pentol (PubChem CID 102312079) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is (2R,4R,5R)-2-methyloxane-2,3,3,4,5-pentol.
| Compound Name | (2R,4R,5R)-2-methyloxane-2,3,3,4,5-pentol |
|---|---|
| PubChem CID | 102312079 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2R,4R,5R)-2-methyloxane-2,3,3,4,5-pentol |
| SMILES | C[C@@]1(O)OC[C@@H](O)[C@@H](O)C1(O)O |
| InChI | InChI=1S/C6H12O6/c1-5(9)6(10,11)4(8)3(7)2-12-5/h3-4,7-11H,2H2,1H3/t3-,4-,5-/m1/s1 |
| InChIKey | YQXNAPYLDCFJNJ-UOWFLXDJSA-N |
| XLogP | -2.87 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|