C8H14O5 — CID 78173804
8-methyl-1,7-dioxaspiro[4.4]nonane-3,4,8-triol (PubChem CID 78173804) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is 8-methyl-1,7-dioxaspiro[4.4]nonane-3,4,8-triol.
| Compound Name | 8-methyl-1,7-dioxaspiro[4.4]nonane-3,4,8-triol |
|---|---|
| PubChem CID | 78173804 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 8-methyl-1,7-dioxaspiro[4.4]nonane-3,4,8-triol |
| SMILES | CC1(O)CC2(CO1)OCC(O)C2O |
| InChI | InChI=1S/C8H14O5/c1-7(11)3-8(4-13-7)6(10)5(9)2-12-8/h5-6,9-11H,2-4H2,1H3 |
| InChIKey | GEMQYLVRMCCZID-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |