C5H8O7 — CID 141078298
(4R,5S,6R)-2,7,8-trioxabicyclo[4.2.0]octane-1,4,5,6-tetrol (PubChem CID 141078298) has the molecular formula C5H8O7 and a molecular weight of 180.11 g/mol. Its IUPAC name is (4R,5S,6R)-2,7,8-trioxabicyclo[4.2.0]octane-1,4,5,6-tetrol.
| Compound Name | (4R,5S,6R)-2,7,8-trioxabicyclo[4.2.0]octane-1,4,5,6-tetrol |
|---|---|
| PubChem CID | 141078298 |
| Molecular Formula | C5H8O7 |
| Molecular Weight | 180.11 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | (4R,5S,6R)-2,7,8-trioxabicyclo[4.2.0]octane-1,4,5,6-tetrol |
| SMILES | O[C@@H]1COC2(O)OO[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C5H8O7/c6-2-1-10-5(9)4(8,3(2)7)11-12-5/h2-3,6-9H,1H2/t2-,3+,4-,5?/m1/s1 |
| InChIKey | RHHWEJQLLOLUKZ-IOVATXLUSA-N |
| XLogP | -2.97 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.11 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|