About 4-oxaspiro[2.5]octane-6,7,8-triol
4-oxaspiro[2.5]octane-6,7,8-triol (PubChem CID 123215793) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 4-oxaspiro[2.5]octane-6,7,8-triol.
Molecular Properties
| Compound Name | 4-oxaspiro[2.5]octane-6,7,8-triol |
| PubChem CID | 123215793 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 4-oxaspiro[2.5]octane-6,7,8-triol |
| SMILES | OC1COC2(CC2)C(O)C1O |
| InChI | InChI=1S/C7H12O4/c8-4-3-11-7(1-2-7)6(10)5(4)9/h4-6,8-10H,1-3H2 |
| InChIKey | UONAEWLXSVUQKT-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxaspiro[2.5]octane-6,7,8-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxaspiro[2.5]octane-6,7,8-triol?
The IUPAC name of 4-oxaspiro[2.5]octane-6,7,8-triol (CID 123215793) is 4-oxaspiro[2.5]octane-6,7,8-triol.
What is the SMILES notation for 4-oxaspiro[2.5]octane-6,7,8-triol?
The canonical SMILES for 4-oxaspiro[2.5]octane-6,7,8-triol is OC1COC2(CC2)C(O)C1O.
What is the InChIKey of 4-oxaspiro[2.5]octane-6,7,8-triol?
The InChIKey is UONAEWLXSVUQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c8-4-3-11-7(1-2-7)6(10)5(4)9/h4-6,8-10H,1-3H2.
What are the key properties of 4-oxaspiro[2.5]octane-6,7,8-triol?
4-oxaspiro[2.5]octane-6,7,8-triol has a molecular weight of 160.17 g/mol, XLogP of -1.37, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxaspiro[2.5]octane-6,7,8-triol is sourced from PubChem (CID 123215793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).