C11H12FN3O5 — CID 58226952
1-[(3aR,6aS)-3-hydroxy-3a-methyl-4-oxo-2,3,6,6a-tetrahydrofuro[2,3-c]furan-2-yl]-4-amino-5-fluoropyrimidin-2-one (PubChem CID 58226952) has the molecular formula C11H12FN3O5 and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-[(3aR,6aS)-3-hydroxy-3a-methyl-4-oxo-2,3,6,6a-tetrahydrofuro[2,3-c]furan-2-yl]-4-amino-5-fluoropyrimidin-2-one.
| Compound Name | 1-[(3aR,6aS)-3-hydroxy-3a-methyl-4-oxo-2,3,6,6a-tetrahydrofuro[2,3-c]furan-2-yl]-4-amino-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 58226952 |
| Molecular Formula | C11H12FN3O5 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-[(3aR,6aS)-3-hydroxy-3a-methyl-4-oxo-2,3,6,6a-tetrahydrofuro[2,3-c]furan-2-yl]-4-amino-5-fluoropyrimidin-2-one |
| SMILES | C[C@]12C(=O)OC[C@H]1OC(n1cc(F)c(N)nc1=O)C2O |
| InChI | InChI=1S/C11H12FN3O5/c1-11-5(3-19-9(11)17)20-8(6(11)16)15-2-4(12)7(13)14-10(15)18/h2,5-6,8,16H,3H2,1H3,(H2,13,14,18)/t5-,6?,8?,11+/m1/s1 |
| InChIKey | CZHWWHKZBXCUOU-RIHKPUGDSA-N |
| XLogP | -1.21 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |