C9H10FN3O6S — CID 101272655
1-[(4aR,6R,7R,7aR)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiin-6-yl]-4-amino-5-fluoropyrimidin-2-one (PubChem CID 101272655) has the molecular formula C9H10FN3O6S and a molecular weight of 307.26 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aR)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiin-6-yl]-4-amino-5-fluoropyrimidin-2-one.
| Compound Name | 1-[(4aR,6R,7R,7aR)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiin-6-yl]-4-amino-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 101272655 |
| Molecular Formula | C9H10FN3O6S |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 1-[(4aR,6R,7R,7aR)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxathiin-6-yl]-4-amino-5-fluoropyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@@H]3COS(=O)O[C@@H]3[C@H]2O)cc1F |
| InChI | InChI=1S/C9H10FN3O6S/c10-3-1-13(9(15)12-7(3)11)8-5(14)6-4(18-8)2-17-20(16)19-6/h1,4-6,8,14H,2H2,(H2,11,12,15)/t4-,5-,6+,8-,20?/m1/s1 |
| InChIKey | PHIUWHMURUHAKG-GKMCQKDISA-N |
| XLogP | -1.78 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |