C9H13BrO3 — CID 174309963
(5S)-2-bromo-3-methoxy-5-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 174309963) has the molecular formula C9H13BrO3 and a molecular weight of 249.10 g/mol. Its IUPAC name is (5S)-2-bromo-3-methoxy-5-methylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (5S)-2-bromo-3-methoxy-5-methylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 174309963 |
| Molecular Formula | C9H13BrO3 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | (5S)-2-bromo-3-methoxy-5-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | COC1=C[C@@H](C)CC(C(=O)O)C1Br |
| InChI | InChI=1S/C9H13BrO3/c1-5-3-6(9(11)12)8(10)7(4-5)13-2/h4-6,8H,3H2,1-2H3,(H,11,12)/t5-,6?,8?/m0/s1 |
| InChIKey | QAMWPFPSLUKMDS-BHZOKHGKSA-N |
| XLogP | 2.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|