About cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid
cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid (PubChem CID 14269839) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid.
Analyze cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid (CID 14269839) is cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid is CO[C@H]1C[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
The InChIKey is LAWCUGGFTNCCKX-DMTCNVIQSA-N. The full InChI is InChI=1S/C5H8O3/c1-8-4-2-3(4)5(6)7/h3-4H,2H2,1H3,(H,6,7)/t3-,4+/m1/s1.
What are the key properties of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid has a molecular weight of 116.12 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid is sourced from PubChem (CID 14269839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).