cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid

C5H8O3 — CID 14269839

IUPACcis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid
SMILESCO[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C5H8O3/c1-8-4-2-3(4)5(6)7/h3-4H,2H2,1H3,(H,6,7)/t3-,4+/m1/s1
InChIKeyLAWCUGGFTNCCKX-DMTCNVIQSA-N
MW116.12 g/mol
LogP0.11
Rot. Bonds2

About cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid

cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid (PubChem CID 14269839) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid
PubChem CID14269839
Molecular FormulaC5H8O3
Molecular Weight116.12 g/mol
Exact Mass116.05
IUPAC Namecis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid
SMILESCO[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C5H8O3/c1-8-4-2-3(4)5(6)7/h3-4H,2H2,1H3,(H,6,7)/t3-,4+/m1/s1
InChIKeyLAWCUGGFTNCCKX-DMTCNVIQSA-N
XLogP0.11
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.12
LogP ≤ 50.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid (CID 14269839) is cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid is CO[C@H]1C[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
The InChIKey is LAWCUGGFTNCCKX-DMTCNVIQSA-N. The full InChI is InChI=1S/C5H8O3/c1-8-4-2-3(4)5(6)7/h3-4H,2H2,1H3,(H,6,7)/t3-,4+/m1/s1.
What are the key properties of cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid has a molecular weight of 116.12 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-methoxycyclopropane-1-carboxylic acid is sourced from PubChem (CID 14269839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).