C7H13NO3 — CID 129270935
(1R)-N-(2-hydroxyethyl)-2-methoxycyclopropane-1-carboxamide (PubChem CID 129270935) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (1R)-N-(2-hydroxyethyl)-2-methoxycyclopropane-1-carboxamide.
| Compound Name | (1R)-N-(2-hydroxyethyl)-2-methoxycyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129270935 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (1R)-N-(2-hydroxyethyl)-2-methoxycyclopropane-1-carboxamide |
| SMILES | COC1C[C@H]1C(=O)NCCO |
| InChI | InChI=1S/C7H13NO3/c1-11-6-4-5(6)7(10)8-2-3-9/h5-6,9H,2-4H2,1H3,(H,8,10)/t5-,6?/m1/s1 |
| InChIKey | KBFBPYJAGXLDGZ-LWOQYNTDSA-N |
| XLogP | -0.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |