(1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid

C8H14O4 — CID 139598760

IUPAC(1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid
SMILESCO[C@H]1C[C@@H](C(=O)O)CC[C@H]1O
InChIInChI=1S/C8H14O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h5-7,9H,2-4H2,1H3,(H,10,11)/t5-,6+,7-/m0/s1
InChIKeyLWIDFEGLHTWDRA-XVMARJQXSA-N
MW174.20 g/mol
LogP0.25
Rot. Bonds2

About (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid

(1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid (PubChem CID 139598760) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name(1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid
PubChem CID139598760
Molecular FormulaC8H14O4
Molecular Weight174.20 g/mol
Exact Mass174.09
IUPAC Name(1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid
SMILESCO[C@H]1C[C@@H](C(=O)O)CC[C@H]1O
InChIInChI=1S/C8H14O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h5-7,9H,2-4H2,1H3,(H,10,11)/t5-,6+,7-/m0/s1
InChIKeyLWIDFEGLHTWDRA-XVMARJQXSA-N
XLogP0.25
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 50.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid?
The IUPAC name of (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid (CID 139598760) is (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid.
What is the SMILES notation for (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid?
The canonical SMILES for (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid is CO[C@H]1C[C@@H](C(=O)O)CC[C@H]1O.
What is the InChIKey of (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid?
The InChIKey is LWIDFEGLHTWDRA-XVMARJQXSA-N. The full InChI is InChI=1S/C8H14O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h5-7,9H,2-4H2,1H3,(H,10,11)/t5-,6+,7-/m0/s1.
What are the key properties of (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid?
(1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid has a molecular weight of 174.20 g/mol, XLogP of 0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3S,4R)-4-hydroxy-3-methoxycyclohexane-1-carboxylic acid is sourced from PubChem (CID 139598760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).