C21H23NO3 — CID 135102555
(1R,3R,4S)-N-(9H-fluoren-9-yl)-4-hydroxy-3-methoxycyclohexane-1-carboxamide (PubChem CID 135102555) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (1R,3R,4S)-N-(9H-fluoren-9-yl)-4-hydroxy-3-methoxycyclohexane-1-carboxamide.
| Compound Name | (1R,3R,4S)-N-(9H-fluoren-9-yl)-4-hydroxy-3-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 135102555 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1R,3R,4S)-N-(9H-fluoren-9-yl)-4-hydroxy-3-methoxycyclohexane-1-carboxamide |
| SMILES | CO[C@@H]1C[C@H](C(=O)NC2c3ccccc3-c3ccccc32)CC[C@@H]1O |
| InChI | InChI=1S/C21H23NO3/c1-25-19-12-13(10-11-18(19)23)21(24)22-20-16-8-4-2-6-14(16)15-7-3-5-9-17(15)20/h2-9,13,18-20,23H,10-12H2,1H3,(H,22,24)/t13-,18+,19-/m1/s1 |
| InChIKey | PAQXESVZVBGLEK-ZNZDAUKMSA-N |
| XLogP | 3.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |