C6H10O4 — CID 141430592
3,4-dimethoxy-2,3-dihydrofuran-2-ol (PubChem CID 141430592) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is 3,4-dimethoxy-2,3-dihydrofuran-2-ol.
| Compound Name | 3,4-dimethoxy-2,3-dihydrofuran-2-ol |
|---|---|
| PubChem CID | 141430592 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 3,4-dimethoxy-2,3-dihydrofuran-2-ol |
| SMILES | COC1=COC(O)C1OC |
| InChI | InChI=1S/C6H10O4/c1-8-4-3-10-6(7)5(4)9-2/h3,5-7H,1-2H3 |
| InChIKey | HGCREOYEQYQYAU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |