About (3R)-3-methoxy-4,4-dimethyloxolan-2-ol
(3R)-3-methoxy-4,4-dimethyloxolan-2-ol (PubChem CID 45082816) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is (3R)-3-methoxy-4,4-dimethyloxolan-2-ol.
Molecular Properties
| Compound Name | (3R)-3-methoxy-4,4-dimethyloxolan-2-ol |
| PubChem CID | 45082816 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (3R)-3-methoxy-4,4-dimethyloxolan-2-ol |
| SMILES | CO[C@H]1C(O)OCC1(C)C |
| InChI | InChI=1S/C7H14O3/c1-7(2)4-10-6(8)5(7)9-3/h5-6,8H,4H2,1-3H3/t5-,6?/m0/s1 |
| InChIKey | VFYJKVIPQITLRZ-ZBHICJROSA-N |
| XLogP | 0.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-methoxy-4,4-dimethyloxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methoxy-4,4-dimethyloxolan-2-ol?
The IUPAC name of (3R)-3-methoxy-4,4-dimethyloxolan-2-ol (CID 45082816) is (3R)-3-methoxy-4,4-dimethyloxolan-2-ol.
What is the SMILES notation for (3R)-3-methoxy-4,4-dimethyloxolan-2-ol?
The canonical SMILES for (3R)-3-methoxy-4,4-dimethyloxolan-2-ol is CO[C@H]1C(O)OCC1(C)C.
What is the InChIKey of (3R)-3-methoxy-4,4-dimethyloxolan-2-ol?
The InChIKey is VFYJKVIPQITLRZ-ZBHICJROSA-N. The full InChI is InChI=1S/C7H14O3/c1-7(2)4-10-6(8)5(7)9-3/h5-6,8H,4H2,1-3H3/t5-,6?/m0/s1.
What are the key properties of (3R)-3-methoxy-4,4-dimethyloxolan-2-ol?
(3R)-3-methoxy-4,4-dimethyloxolan-2-ol has a molecular weight of 146.19 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methoxy-4,4-dimethyloxolan-2-ol is sourced from PubChem (CID 45082816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).