C7H14O3 — CID 45082816
(3R)-3-methoxy-4,4-dimethyloxolan-2-ol (PubChem CID 45082816) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (3R)-3-methoxy-4,4-dimethyloxolan-2-ol.
| Compound Name | (3R)-3-methoxy-4,4-dimethyloxolan-2-ol |
|---|---|
| PubChem CID | 45082816 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (3R)-3-methoxy-4,4-dimethyloxolan-2-ol |
| SMILES | CO[C@H]1C(O)OCC1(C)C |
| InChI | InChI=1S/C7H14O3/c1-7(2)4-10-6(8)5(7)9-3/h5-6,8H,4H2,1-3H3/t5-,6?/m0/s1 |
| InChIKey | VFYJKVIPQITLRZ-ZBHICJROSA-N |
| XLogP | 0.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |