C11H22O4 — CID 152784004
2,4,5-trimethoxy-2,4,6-trimethyloxane (PubChem CID 152784004) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2,4,5-trimethoxy-2,4,6-trimethyloxane.
| Compound Name | 2,4,5-trimethoxy-2,4,6-trimethyloxane |
|---|---|
| PubChem CID | 152784004 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2,4,5-trimethoxy-2,4,6-trimethyloxane |
| SMILES | COC1C(C)OC(C)(OC)CC1(C)OC |
| InChI | InChI=1S/C11H22O4/c1-8-9(12-4)10(2,13-5)7-11(3,14-6)15-8/h8-9H,7H2,1-6H3 |
| InChIKey | RUJMXTDUJRASRT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |