C10H20O3 — CID 70252903
(2R,4R,6S)-5-ethyl-4-methoxy-4,6-dimethyloxan-2-ol (PubChem CID 70252903) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2R,4R,6S)-5-ethyl-4-methoxy-4,6-dimethyloxan-2-ol.
| Compound Name | (2R,4R,6S)-5-ethyl-4-methoxy-4,6-dimethyloxan-2-ol |
|---|---|
| PubChem CID | 70252903 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2R,4R,6S)-5-ethyl-4-methoxy-4,6-dimethyloxan-2-ol |
| SMILES | CCC1[C@H](C)O[C@@H](O)C[C@@]1(C)OC |
| InChI | InChI=1S/C10H20O3/c1-5-8-7(2)13-9(11)6-10(8,3)12-4/h7-9,11H,5-6H2,1-4H3/t7-,8?,9+,10+/m0/s1 |
| InChIKey | WTDAIPZDFLWJSQ-NKSXPTFNSA-N |
| XLogP | 1.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |