C9H19NO2 — CID 134401507
(2S,3R,4R,6S)-4-methoxy-2,4,6-trimethyloxan-3-amine (PubChem CID 134401507) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S,3R,4R,6S)-4-methoxy-2,4,6-trimethyloxan-3-amine.
| Compound Name | (2S,3R,4R,6S)-4-methoxy-2,4,6-trimethyloxan-3-amine |
|---|---|
| PubChem CID | 134401507 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2S,3R,4R,6S)-4-methoxy-2,4,6-trimethyloxan-3-amine |
| SMILES | CO[C@]1(C)C[C@H](C)O[C@@H](C)[C@H]1N |
| InChI | InChI=1S/C9H19NO2/c1-6-5-9(3,11-4)8(10)7(2)12-6/h6-8H,5,10H2,1-4H3/t6-,7-,8+,9+/m0/s1 |
| InChIKey | JPHDTXJAGZRGDY-RBXMUDONSA-N |
| XLogP | 0.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |