C13H24O4 — CID 118585688
1-[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone (PubChem CID 118585688) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone.
| Compound Name | 1-[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 118585688 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone |
| SMILES | CC[C@H]1[C@@H](C)[C@@H](C(C)=O)O[C@H](OC)[C@]1(C)OC |
| InChI | InChI=1S/C13H24O4/c1-7-10-8(2)11(9(3)14)17-12(15-5)13(10,4)16-6/h8,10-12H,7H2,1-6H3/t8-,10+,11+,12+,13-/m1/s1 |
| InChIKey | GICDYVQXRCFENU-ZLZRZKQWSA-N |
| XLogP | 2.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |