C8H16O4 — CID 738898
(2S,5R)-2,5-dimethoxy-2,5-dimethyl-1,4-dioxane (PubChem CID 738898) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethoxy-2,5-dimethyl-1,4-dioxane.
| Compound Name | (2S,5R)-2,5-dimethoxy-2,5-dimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 738898 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2S,5R)-2,5-dimethoxy-2,5-dimethyl-1,4-dioxane |
| SMILES | CO[C@]1(C)CO[C@@](C)(OC)CO1 |
| InChI | InChI=1S/C8H16O4/c1-7(9-3)5-12-8(2,10-4)6-11-7/h5-6H2,1-4H3/t7-,8+ |
| InChIKey | UUGSNNUEVKTATH-OCAPTIKFSA-N |
| XLogP | 0.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |