C8H16O4 — CID 100924891
(1R,2R,3S,5R)-5-methoxy-4,4-dimethylcyclopentane-1,2,3-triol (PubChem CID 100924891) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (1R,2R,3S,5R)-5-methoxy-4,4-dimethylcyclopentane-1,2,3-triol.
| Compound Name | (1R,2R,3S,5R)-5-methoxy-4,4-dimethylcyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 100924891 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (1R,2R,3S,5R)-5-methoxy-4,4-dimethylcyclopentane-1,2,3-triol |
| SMILES | CO[C@H]1[C@H](O)[C@H](O)[C@@H](O)C1(C)C |
| InChI | InChI=1S/C8H16O4/c1-8(2)6(11)4(9)5(10)7(8)12-3/h4-7,9-11H,1-3H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | KJTQMFVCTMAIES-WNJXEPBRSA-N |
| XLogP | -0.88 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |