About 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol
5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol (PubChem CID 122597346) has the molecular formula C8H15IO5
and a molecular weight of 318.11 g/mol. Its IUPAC name is 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol |
| PubChem CID | 122597346 |
| Molecular Formula | C8H15IO5 |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol |
| SMILES | COC1C(O)C(O)C(O)CC1(I)CO |
| InChI | InChI=1S/C8H15IO5/c1-14-7-6(13)5(12)4(11)2-8(7,9)3-10/h4-7,10-13H,2-3H2,1H3 |
| InChIKey | SOSLBSDPHDYHEX-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol?
The IUPAC name of 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol (CID 122597346) is 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol.
What is the SMILES notation for 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol?
The canonical SMILES for 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol is COC1C(O)C(O)C(O)CC1(I)CO.
What is the InChIKey of 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol?
The InChIKey is SOSLBSDPHDYHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15IO5/c1-14-7-6(13)5(12)4(11)2-8(7,9)3-10/h4-7,10-13H,2-3H2,1H3.
What are the key properties of 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol?
5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol has a molecular weight of 318.11 g/mol, XLogP of -1.35, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-5-iodo-4-methoxycyclohexane-1,2,3-triol is sourced from PubChem (CID 122597346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).