C9H18O4 — CID 167690761
(4R)-2-ethyl-2-methoxy-4-methyloxane-3,5-diol (PubChem CID 167690761) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (4R)-2-ethyl-2-methoxy-4-methyloxane-3,5-diol.
| Compound Name | (4R)-2-ethyl-2-methoxy-4-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 167690761 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (4R)-2-ethyl-2-methoxy-4-methyloxane-3,5-diol |
| SMILES | CCC1(OC)OCC(O)[C@@H](C)C1O |
| InChI | InChI=1S/C9H18O4/c1-4-9(12-3)8(11)6(2)7(10)5-13-9/h6-8,10-11H,4-5H2,1-3H3/t6-,7?,8?,9?/m1/s1 |
| InChIKey | YDTDLCJNNGTLIW-LJSVPSOQSA-N |
| XLogP | 0.13 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |