C11H21ClO4S — CID 123736889
2-(2-chloropropyl)-5-methoxy-6-methyl-6-methylsulfanyloxane-3,4-diol (PubChem CID 123736889) has the molecular formula C11H21ClO4S and a molecular weight of 284.81 g/mol. Its IUPAC name is 2-(2-chloropropyl)-5-methoxy-6-methyl-6-methylsulfanyloxane-3,4-diol.
| Compound Name | 2-(2-chloropropyl)-5-methoxy-6-methyl-6-methylsulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 123736889 |
| Molecular Formula | C11H21ClO4S |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(2-chloropropyl)-5-methoxy-6-methyl-6-methylsulfanyloxane-3,4-diol |
| SMILES | COC1C(O)C(O)C(CC(C)Cl)OC1(C)SC |
| InChI | InChI=1S/C11H21ClO4S/c1-6(12)5-7-8(13)9(14)10(15-3)11(2,16-7)17-4/h6-10,13-14H,5H2,1-4H3 |
| InChIKey | UGJTYTAXYIJHQY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|