C13H28O2 — CID 143101195
ethane;(2S,3R,4S)-3-methoxy-2,4-dimethyl-4-propan-2-yloxane (PubChem CID 143101195) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is ethane;(2S,3R,4S)-3-methoxy-2,4-dimethyl-4-propan-2-yloxane.
| Compound Name | ethane;(2S,3R,4S)-3-methoxy-2,4-dimethyl-4-propan-2-yloxane |
|---|---|
| PubChem CID | 143101195 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | ethane;(2S,3R,4S)-3-methoxy-2,4-dimethyl-4-propan-2-yloxane |
| SMILES | CC.CO[C@H]1[C@H](C)OCC[C@@]1(C)C(C)C |
| InChI | InChI=1S/C11H22O2.C2H6/c1-8(2)11(4)6-7-13-9(3)10(11)12-5;1-2/h8-10H,6-7H2,1-5H3;1-2H3/t9-,10-,11-;/m0./s1 |
| InChIKey | BFILWMVTOHFIHB-AELSBENASA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |