C10H20O2 — CID 142311739
4,5-dimethyl-1,6-dioxaspiro[2.5]octane;ethane (PubChem CID 142311739) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 4,5-dimethyl-1,6-dioxaspiro[2.5]octane;ethane.
| Compound Name | 4,5-dimethyl-1,6-dioxaspiro[2.5]octane;ethane |
|---|---|
| PubChem CID | 142311739 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 4,5-dimethyl-1,6-dioxaspiro[2.5]octane;ethane |
| SMILES | CC.CC1OCCC2(CO2)C1C |
| InChI | InChI=1S/C8H14O2.C2H6/c1-6-7(2)9-4-3-8(6)5-10-8;1-2/h6-7H,3-5H2,1-2H3;1-2H3 |
| InChIKey | BZFBZLMITWKYQN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|