C8H15NO3 — CID 129313677
(2S,4R)-4-methoxy-2,4-dimethyl-3-nitrosooxane (PubChem CID 129313677) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (2S,4R)-4-methoxy-2,4-dimethyl-3-nitrosooxane.
| Compound Name | (2S,4R)-4-methoxy-2,4-dimethyl-3-nitrosooxane |
|---|---|
| PubChem CID | 129313677 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (2S,4R)-4-methoxy-2,4-dimethyl-3-nitrosooxane |
| SMILES | CO[C@]1(C)CCO[C@@H](C)C1N=O |
| InChI | InChI=1S/C8H15NO3/c1-6-7(9-10)8(2,11-3)4-5-12-6/h6-7H,4-5H2,1-3H3/t6-,7?,8+/m0/s1 |
| InChIKey | UUZPYHMZXBSAFB-YPVSKDHRSA-N |
| XLogP | 1.34 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |