C11H23NO2 — CID 103581330
N-(4-methoxybutan-2-yl)-2,3-dimethyloxolan-3-amine (PubChem CID 103581330) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(4-methoxybutan-2-yl)-2,3-dimethyloxolan-3-amine.
| Compound Name | N-(4-methoxybutan-2-yl)-2,3-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 103581330 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-(4-methoxybutan-2-yl)-2,3-dimethyloxolan-3-amine |
| SMILES | COCCC(C)NC1(C)CCOC1C |
| InChI | InChI=1S/C11H23NO2/c1-9(5-7-13-4)12-11(3)6-8-14-10(11)2/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | TYUYDTCYIVWMCD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |