C12H25NO2 — CID 103581433
N-(2-butoxyethyl)-2,3-dimethyloxolan-3-amine (PubChem CID 103581433) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(2-butoxyethyl)-2,3-dimethyloxolan-3-amine.
| Compound Name | N-(2-butoxyethyl)-2,3-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 103581433 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-(2-butoxyethyl)-2,3-dimethyloxolan-3-amine |
| SMILES | CCCCOCCNC1(C)CCOC1C |
| InChI | InChI=1S/C12H25NO2/c1-4-5-8-14-10-7-13-12(3)6-9-15-11(12)2/h11,13H,4-10H2,1-3H3 |
| InChIKey | VOLZCAZOFBDHOG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|