C11H21NO3 — CID 124681147
methyl 4-[[(2R,3R)-2,3-dimethyloxolan-3-yl]amino]butanoate (PubChem CID 124681147) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl 4-[[(2R,3R)-2,3-dimethyloxolan-3-yl]amino]butanoate.
| Compound Name | methyl 4-[[(2R,3R)-2,3-dimethyloxolan-3-yl]amino]butanoate |
|---|---|
| PubChem CID | 124681147 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | methyl 4-[[(2R,3R)-2,3-dimethyloxolan-3-yl]amino]butanoate |
| SMILES | COC(=O)CCCN[C@]1(C)CCO[C@@H]1C |
| InChI | InChI=1S/C11H21NO3/c1-9-11(2,6-8-15-9)12-7-4-5-10(13)14-3/h9,12H,4-8H2,1-3H3/t9-,11-/m1/s1 |
| InChIKey | IJWPMOZAUYWHEL-MWLCHTKSSA-N |
| XLogP | 1.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|