C12H25NO — CID 103581298
N-hexyl-2,3-dimethyloxolan-3-amine (PubChem CID 103581298) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is N-hexyl-2,3-dimethyloxolan-3-amine.
| Compound Name | N-hexyl-2,3-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 103581298 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N-hexyl-2,3-dimethyloxolan-3-amine |
| SMILES | CCCCCCNC1(C)CCOC1C |
| InChI | InChI=1S/C12H25NO/c1-4-5-6-7-9-13-12(3)8-10-14-11(12)2/h11,13H,4-10H2,1-3H3 |
| InChIKey | KXXIGAWIGDRNRN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|