C9H17NO2 — CID 70313279
(3aR,4S,7aS)-3,4,7a-trimethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole (PubChem CID 70313279) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (3aR,4S,7aS)-3,4,7a-trimethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole.
| Compound Name | (3aR,4S,7aS)-3,4,7a-trimethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole |
|---|---|
| PubChem CID | 70313279 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3aR,4S,7aS)-3,4,7a-trimethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole |
| SMILES | C[C@@H]1OCC[C@]2(C)OCN(C)[C@H]12 |
| InChI | InChI=1S/C9H17NO2/c1-7-8-9(2,4-5-11-7)12-6-10(8)3/h7-8H,4-6H2,1-3H3/t7-,8+,9-/m0/s1 |
| InChIKey | RUKLCPMYKMOHLF-YIZRAAEISA-N |
| XLogP | 0.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |