C21H43N2O5P — CID 159408769
3,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole;3-[dimethylphosphoryl(methyl)amino]-2,4,6-trimethyloxan-4-ol (PubChem CID 159408769) has the molecular formula C21H43N2O5P and a molecular weight of 434.56 g/mol. Its IUPAC name is 3,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole;3-[dimethylphosphoryl(methyl)amino]-2,4,6-trimethyloxan-4-ol.
| Compound Name | 3,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole;3-[dimethylphosphoryl(methyl)amino]-2,4,6-trimethyloxan-4-ol |
|---|---|
| PubChem CID | 159408769 |
| Molecular Formula | C21H43N2O5P |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 3,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazole;3-[dimethylphosphoryl(methyl)amino]-2,4,6-trimethyloxan-4-ol |
| SMILES | CC1CC(C)(O)C(N(C)P(C)(C)=O)C(C)O1.CC1CC2(C)OCN(C)C2C(C)O1 |
| InChI | InChI=1S/C11H24NO3P.C10H19NO2/c1-8-7-11(3,13)10(9(2)15-8)12(4)16(5,6)14;1-7-5-10(3)9(8(2)13-7)11(4)6-12-10/h8-10,13H,7H2,1-6H3;7-9H,5-6H2,1-4H3 |
| InChIKey | LOHODORLNXZIPT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|