C7H14O5 — CID 130978122
(3S,4S,5R)-6,6-dimethyloxane-2,3,4,5-tetrol (PubChem CID 130978122) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (3S,4S,5R)-6,6-dimethyloxane-2,3,4,5-tetrol.
| Compound Name | (3S,4S,5R)-6,6-dimethyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 130978122 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (3S,4S,5R)-6,6-dimethyloxane-2,3,4,5-tetrol |
| SMILES | CC1(C)OC(O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O5/c1-7(2)5(10)3(8)4(9)6(11)12-7/h3-6,8-11H,1-2H3/t3-,4+,5-,6?/m1/s1 |
| InChIKey | JXMNUDDLKRSCSG-IANNHFEVSA-N |
| XLogP | -1.80 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |