C8H16O3 — CID 178008700
(3R,4R,6S)-2,2,6-trimethyloxane-3,4-diol (PubChem CID 178008700) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (3R,4R,6S)-2,2,6-trimethyloxane-3,4-diol.
| Compound Name | (3R,4R,6S)-2,2,6-trimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 178008700 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3R,4R,6S)-2,2,6-trimethyloxane-3,4-diol |
| SMILES | C[C@H]1C[C@@H](O)[C@@H](O)C(C)(C)O1 |
| InChI | InChI=1S/C8H16O3/c1-5-4-6(9)7(10)8(2,3)11-5/h5-7,9-10H,4H2,1-3H3/t5-,6+,7+/m0/s1 |
| InChIKey | MQHSUIUVUFHBOI-RRKCRQDMSA-N |
| XLogP | 0.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |