C9H18O3 — CID 14705267
2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanol (PubChem CID 14705267) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanol.
| Compound Name | 2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanol |
|---|---|
| PubChem CID | 14705267 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanol |
| SMILES | C[C@@H]1C[C@H](CCO)OC(C)(C)O1 |
| InChI | InChI=1S/C9H18O3/c1-7-6-8(4-5-10)12-9(2,3)11-7/h7-8,10H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | NEYDUNXHFQSHIM-SFYZADRCSA-N |
| XLogP | 1.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |