C12H22O5 — CID 16746176
(2R,4S,5R,6R,8R)-2-(2-hydroxyethyl)-8-methyl-1,7-dioxaspiro[5.5]undecane-4,5-diol (PubChem CID 16746176) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (2R,4S,5R,6R,8R)-2-(2-hydroxyethyl)-8-methyl-1,7-dioxaspiro[5.5]undecane-4,5-diol.
| Compound Name | (2R,4S,5R,6R,8R)-2-(2-hydroxyethyl)-8-methyl-1,7-dioxaspiro[5.5]undecane-4,5-diol |
|---|---|
| PubChem CID | 16746176 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2R,4S,5R,6R,8R)-2-(2-hydroxyethyl)-8-methyl-1,7-dioxaspiro[5.5]undecane-4,5-diol |
| SMILES | C[C@@H]1CCC[C@]2(O[C@H](CCO)C[C@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C12H22O5/c1-8-3-2-5-12(16-8)11(15)10(14)7-9(17-12)4-6-13/h8-11,13-15H,2-7H2,1H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | ZNKRNBMMTYREOQ-RMPHRYRLSA-N |
| XLogP | 0.16 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |