C16H22O5 — CID 25161754
(2R,3'S,4'R,6'S)-6'-(2-hydroxyethyl)spiro[4,5-dihydro-3H-1-benzoxepine-2,2'-oxane]-3',4'-diol (PubChem CID 25161754) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2R,3'S,4'R,6'S)-6'-(2-hydroxyethyl)spiro[4,5-dihydro-3H-1-benzoxepine-2,2'-oxane]-3',4'-diol.
| Compound Name | (2R,3'S,4'R,6'S)-6'-(2-hydroxyethyl)spiro[4,5-dihydro-3H-1-benzoxepine-2,2'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 25161754 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2R,3'S,4'R,6'S)-6'-(2-hydroxyethyl)spiro[4,5-dihydro-3H-1-benzoxepine-2,2'-oxane]-3',4'-diol |
| SMILES | OCC[C@H]1C[C@@H](O)[C@H](O)[C@]2(CCCc3ccccc3O2)O1 |
| InChI | InChI=1S/C16H22O5/c17-9-7-12-10-13(18)15(19)16(20-12)8-3-5-11-4-1-2-6-14(11)21-16/h1-2,4,6,12-13,15,17-19H,3,5,7-10H2/t12-,13+,15-,16+/m0/s1 |
| InChIKey | JAQDGLMKQTUFFQ-LQKXBSAESA-N |
| XLogP | 0.99 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |