C9H16O3 — CID 11579201
1-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanone (PubChem CID 11579201) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 1-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanone.
| Compound Name | 1-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 11579201 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]ethanone |
| SMILES | CC(=O)[C@H]1C[C@@H](C)OC(C)(C)O1 |
| InChI | InChI=1S/C9H16O3/c1-6-5-8(7(2)10)12-9(3,4)11-6/h6,8H,5H2,1-4H3/t6-,8-/m1/s1 |
| InChIKey | HHYGTHSIWBRZJB-HTRCEHHLSA-N |
| XLogP | 1.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |