About (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde
(3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde (PubChem CID 174638920) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde |
| PubChem CID | 174638920 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde |
| SMILES | CC1(C)COC(C=O)[C@@H]1O |
| InChI | InChI=1S/C7H12O3/c1-7(2)4-10-5(3-8)6(7)9/h3,5-6,9H,4H2,1-2H3/t5?,6-/m0/s1 |
| InChIKey | HDBRFYMFPRATGT-GDVGLLTNSA-N |
| XLogP | -0.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde?
The IUPAC name of (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde (CID 174638920) is (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde.
What is the SMILES notation for (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde?
The canonical SMILES for (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde is CC1(C)COC(C=O)[C@@H]1O.
What is the InChIKey of (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde?
The InChIKey is HDBRFYMFPRATGT-GDVGLLTNSA-N. The full InChI is InChI=1S/C7H12O3/c1-7(2)4-10-5(3-8)6(7)9/h3,5-6,9H,4H2,1-2H3/t5?,6-/m0/s1.
What are the key properties of (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde?
(3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde has a molecular weight of 144.17 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde is sourced from PubChem (CID 174638920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).