C7H12O3 — CID 174638920
(3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde (PubChem CID 174638920) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde.
| Compound Name | (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 174638920 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3R)-3-hydroxy-4,4-dimethyloxolane-2-carbaldehyde |
| SMILES | CC1(C)COC(C=O)[C@@H]1O |
| InChI | InChI=1S/C7H12O3/c1-7(2)4-10-5(3-8)6(7)9/h3,5-6,9H,4H2,1-2H3/t5?,6-/m0/s1 |
| InChIKey | HDBRFYMFPRATGT-GDVGLLTNSA-N |
| XLogP | -0.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|